About 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane
1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane (PubChem CID 130393355) has the molecular formula C21H18BrClFN3
and a molecular weight of 446.75 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane |
| PubChem CID | 130393355 |
| Molecular Formula | C21H18BrClFN3 |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane |
| SMILES | Fc1ccc(N2CN(c3ccc(Cl)cc3)CN(c3ccc(Br)cc3)C2)cc1 |
| InChI | InChI=1S/C21H18BrClFN3/c22-16-1-7-19(8-2-16)25-13-26(20-9-3-17(23)4-10-20)15-27(14-25)21-11-5-18(24)6-12-21/h1-12H,13-15H2 |
| InChIKey | SQBWUTUTMXIMPD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane?
The IUPAC name of 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane (CID 130393355) is 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane.
What is the SMILES notation for 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane?
The canonical SMILES for 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane is Fc1ccc(N2CN(c3ccc(Cl)cc3)CN(c3ccc(Br)cc3)C2)cc1.
What is the InChIKey of 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane?
The InChIKey is SQBWUTUTMXIMPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18BrClFN3/c22-16-1-7-19(8-2-16)25-13-26(20-9-3-17(23)4-10-20)15-27(14-25)21-11-5-18(24)6-12-21/h1-12H,13-15H2.
What are the key properties of 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane?
1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane has a molecular weight of 446.75 g/mol, XLogP of 5.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-3-(4-chlorophenyl)-5-(4-fluorophenyl)-1,3,5-triazinane is sourced from PubChem (CID 130393355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).