C42H27N5 — CID 130393650
9-[4-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene (PubChem CID 130393650) has the molecular formula C42H27N5 and a molecular weight of 601.71 g/mol. Its IUPAC name is 9-[4-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene.
| Compound Name | 9-[4-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
|---|---|
| PubChem CID | 130393650 |
| Molecular Formula | C42H27N5 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | 9-[4-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]phenyl]-8,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,12,14,16-octaene |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4ccc(-c5nc6ccccc6c6nc7ccccn7c56)cc4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C42H27N5/c1-3-12-28(13-4-1)32-16-11-17-33(26-32)37-27-36(44-42(45-37)31-14-5-2-6-15-31)29-21-23-30(24-22-29)39-41-40(34-18-7-8-19-35(34)43-39)46-38-20-9-10-25-47(38)41/h1-27H |
| InChIKey | KEWLYFAXDBTQAF-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |