C50H36N4 — CID 130393659
3-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-5-[4-[3-[2-(3-phenylphenyl)quinazolin-4-yl]phenyl]phenyl]benzo[h][1,6]naphthyridine (PubChem CID 130393659) has the molecular formula C50H36N4 and a molecular weight of 692.87 g/mol. Its IUPAC name is 3-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-5-[4-[3-[2-(3-phenylphenyl)quinazolin-4-yl]phenyl]phenyl]benzo[h][1,6]naphthyridine.
| Compound Name | 3-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-5-[4-[3-[2-(3-phenylphenyl)quinazolin-4-yl]phenyl]phenyl]benzo[h][1,6]naphthyridine |
|---|---|
| PubChem CID | 130393659 |
| Molecular Formula | C50H36N4 |
| Molecular Weight | 692.87 g/mol |
| Exact Mass | 692.29 |
| IUPAC Name | 3-methyl-2-[(1Z,3Z)-penta-1,3-dienyl]-5-[4-[3-[2-(3-phenylphenyl)quinazolin-4-yl]phenyl]phenyl]benzo[h][1,6]naphthyridine |
| SMILES | C/C=C\C=C/c1nc2c(cc1C)c(-c1ccc(-c3cccc(-c4nc(-c5cccc(-c6ccccc6)c5)nc5ccccc45)c3)cc1)nc1ccccc12 |
| InChI | InChI=1S/C50H36N4/c1-3-4-6-23-44-33(2)30-43-47(52-45-24-11-10-22-42(45)49(43)51-44)36-28-26-35(27-29-36)37-17-13-19-39(31-37)48-41-21-9-12-25-46(41)53-50(54-48)40-20-14-18-38(32-40)34-15-7-5-8-16-34/h3-32H,1-2H3/b4-3-,23-6- |
| InChIKey | VWHBSJNTPZXULT-DTFQWTNUSA-N |
| XLogP | 12.96 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.87 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|