About 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine
1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine (PubChem CID 130394109) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine.
Molecular Properties
| Compound Name | 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine |
| PubChem CID | 130394109 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine |
| SMILES | C=C/C(C)=c1/nc(CC(C)N)cc/c1=C/CC |
| InChI | InChI=1S/C15H22N2/c1-5-7-13-8-9-14(10-12(4)16)17-15(13)11(3)6-2/h6-9,12H,2,5,10,16H2,1,3-4H3/b13-7-,15-11+ |
| InChIKey | WNEWWNFTPFKXIR-BMLJDDBMSA-N |
| XLogP | 1.52 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine?
The IUPAC name of 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine (CID 130394109) is 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine.
What is the SMILES notation for 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine?
The canonical SMILES for 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine is C=C/C(C)=c1/nc(CC(C)N)cc/c1=C/CC.
What is the InChIKey of 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine?
The InChIKey is WNEWWNFTPFKXIR-BMLJDDBMSA-N. The full InChI is InChI=1S/C15H22N2/c1-5-7-13-8-9-14(10-12(4)16)17-15(13)11(3)6-2/h6-9,12H,2,5,10,16H2,1,3-4H3/b13-7-,15-11+.
What are the key properties of 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine?
1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine has a molecular weight of 230.35 g/mol, XLogP of 1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5Z,6E)-6-but-3-en-2-ylidene-5-propylidene-2-pyridinyl]propan-2-amine is sourced from PubChem (CID 130394109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).