About chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane
chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane (PubChem CID 130394359) has the molecular formula C10H17ClS
and a molecular weight of 204.77 g/mol. Its IUPAC name is chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane.
Molecular Properties
| Compound Name | chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane |
| PubChem CID | 130394359 |
| Molecular Formula | C10H17ClS |
| Molecular Weight | 204.77 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane |
| SMILES | C=C(C#CC)C(C)(C)S(C)(C)Cl |
| InChI | InChI=1S/C10H17ClS/c1-7-8-9(2)10(3,4)12(5,6)11/h2H2,1,3-6H3 |
| InChIKey | ZIQDSIYRBMWCIN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.77 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane?
The IUPAC name of chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane (CID 130394359) is chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane.
What is the SMILES notation for chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane?
The canonical SMILES for chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane is C=C(C#CC)C(C)(C)S(C)(C)Cl.
What is the InChIKey of chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane?
The InChIKey is ZIQDSIYRBMWCIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClS/c1-7-8-9(2)10(3,4)12(5,6)11/h2H2,1,3-6H3.
What are the key properties of chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane?
chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane has a molecular weight of 204.77 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-dimethyl-(2-methyl-3-methylidenehex-4-yn-2-yl)-λ4-sulfane is sourced from PubChem (CID 130394359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).