C19H17F3N2O2 — CID 130394480
6-methanimidoyl-2-[4-(trifluoromethoxy)benzenecarboximidoyl]-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 130394480) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 6-methanimidoyl-2-[4-(trifluoromethoxy)benzenecarboximidoyl]-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 6-methanimidoyl-2-[4-(trifluoromethoxy)benzenecarboximidoyl]-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 130394480 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 6-methanimidoyl-2-[4-(trifluoromethoxy)benzenecarboximidoyl]-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | [H]/N=C(\c1ccc(OC(F)(F)F)cc1)C1CCc2cc(/C=N/[H])ccc2C1O |
| InChI | InChI=1S/C19H17F3N2O2/c20-19(21,22)26-14-5-2-12(3-6-14)17(24)16-8-4-13-9-11(10-23)1-7-15(13)18(16)25/h1-3,5-7,9-10,16,18,23-25H,4,8H2/b23-10+,24-17+ |
| InChIKey | FSCNJHUSKUTETF-QLQRLZGLSA-N |
| XLogP | 4.25 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|