About N,4-dimethylpenta-1,2,4-trien-3-amine
N,4-dimethylpenta-1,2,4-trien-3-amine (PubChem CID 130394539) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is N,4-dimethylpenta-1,2,4-trien-3-amine.
Molecular Properties
| Compound Name | N,4-dimethylpenta-1,2,4-trien-3-amine |
| PubChem CID | 130394539 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | N,4-dimethylpenta-1,2,4-trien-3-amine |
| SMILES | C=C=C(NC)C(=C)C |
| InChI | InChI=1S/C7H11N/c1-5-7(8-4)6(2)3/h8H,1-2H2,3-4H3 |
| InChIKey | LQFOFSMLQLQWDY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N,4-dimethylpenta-1,2,4-trien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethylpenta-1,2,4-trien-3-amine?
The IUPAC name of N,4-dimethylpenta-1,2,4-trien-3-amine (CID 130394539) is N,4-dimethylpenta-1,2,4-trien-3-amine.
What is the SMILES notation for N,4-dimethylpenta-1,2,4-trien-3-amine?
The canonical SMILES for N,4-dimethylpenta-1,2,4-trien-3-amine is C=C=C(NC)C(=C)C.
What is the InChIKey of N,4-dimethylpenta-1,2,4-trien-3-amine?
The InChIKey is LQFOFSMLQLQWDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N/c1-5-7(8-4)6(2)3/h8H,1-2H2,3-4H3.
What are the key properties of N,4-dimethylpenta-1,2,4-trien-3-amine?
N,4-dimethylpenta-1,2,4-trien-3-amine has a molecular weight of 109.17 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethylpenta-1,2,4-trien-3-amine is sourced from PubChem (CID 130394539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).