C20H21ClN4O2S2 — CID 130394875
4a-[3-chloro-5-(7-methoxy-1H-indol-2-yl)thiophen-2-yl]-2-methyl-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-3-amine (PubChem CID 130394875) has the molecular formula C20H21ClN4O2S2 and a molecular weight of 449.00 g/mol. Its IUPAC name is 4a-[3-chloro-5-(7-methoxy-1H-indol-2-yl)thiophen-2-yl]-2-methyl-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-3-amine.
| Compound Name | 4a-[3-chloro-5-(7-methoxy-1H-indol-2-yl)thiophen-2-yl]-2-methyl-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-3-amine |
|---|---|
| PubChem CID | 130394875 |
| Molecular Formula | C20H21ClN4O2S2 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 4a-[3-chloro-5-(7-methoxy-1H-indol-2-yl)thiophen-2-yl]-2-methyl-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-3-amine |
| SMILES | COc1cccc2cc(-c3cc(Cl)c(C45CCOCC4SN(C)C(N)=N5)s3)[nH]c12 |
| InChI | InChI=1S/C20H21ClN4O2S2/c1-25-19(22)24-20(6-7-27-10-16(20)29-25)18-12(21)9-15(28-18)13-8-11-4-3-5-14(26-2)17(11)23-13/h3-5,8-9,16,23H,6-7,10H2,1-2H3,(H2,22,24) |
| InChIKey | FKNCUCMVVPTLMS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|