C12H14ClN3O5S2 — CID 130394936
5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-chlorothiophene-2-carboxylic acid (PubChem CID 130394936) has the molecular formula C12H14ClN3O5S2 and a molecular weight of 379.85 g/mol. Its IUPAC name is 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-chlorothiophene-2-carboxylic acid.
| Compound Name | 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-chlorothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 130394936 |
| Molecular Formula | C12H14ClN3O5S2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-chlorothiophene-2-carboxylic acid |
| SMILES | CN1C(N)=N[C@@]2(c3sc(C(=O)O)cc3Cl)CCOCC2S1(=O)=O |
| InChI | InChI=1S/C12H14ClN3O5S2/c1-16-11(14)15-12(2-3-21-5-8(12)23(16,19)20)9-6(13)4-7(22-9)10(17)18/h4,8H,2-3,5H2,1H3,(H2,14,15)(H,17,18)/t8?,12-/m0/s1 |
| InChIKey | ZPVWWEOTPLIUJK-MYIOLCAUSA-N |
| XLogP | 0.67 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |