About (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane
(2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane (PubChem CID 130395083) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane.
Molecular Properties
| Compound Name | (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane |
| PubChem CID | 130395083 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane |
| SMILES | COCC1CO[C@@H](C)[C@@H](C)C1 |
| InChI | InChI=1S/C9H18O2/c1-7-4-9(5-10-3)6-11-8(7)2/h7-9H,4-6H2,1-3H3/t7-,8-,9?/m0/s1 |
| InChIKey | CFJJAQGVFOKCEC-JVIMKECRSA-N |
| XLogP | 1.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane?
The IUPAC name of (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane (CID 130395083) is (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane.
What is the SMILES notation for (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane?
The canonical SMILES for (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane is COCC1CO[C@@H](C)[C@@H](C)C1.
What is the InChIKey of (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane?
The InChIKey is CFJJAQGVFOKCEC-JVIMKECRSA-N. The full InChI is InChI=1S/C9H18O2/c1-7-4-9(5-10-3)6-11-8(7)2/h7-9H,4-6H2,1-3H3/t7-,8-,9?/m0/s1.
What are the key properties of (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane?
(2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane has a molecular weight of 158.24 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-5-(methoxymethyl)-2,3-dimethyloxane is sourced from PubChem (CID 130395083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).