C10H13F — CID 130395624
1-tert-butyl-2,3,5,6-tetradeuterio-4-fluorobenzene (PubChem CID 130395624) has the molecular formula C10H13F and a molecular weight of 156.24 g/mol. Its IUPAC name is 1-tert-butyl-2,3,5,6-tetradeuterio-4-fluorobenzene.
| Compound Name | 1-tert-butyl-2,3,5,6-tetradeuterio-4-fluorobenzene |
|---|---|
| PubChem CID | 130395624 |
| Molecular Formula | C10H13F |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1-tert-butyl-2,3,5,6-tetradeuterio-4-fluorobenzene |
| SMILES | [2H]c1c([2H])c(C(C)(C)C)c([2H])c([2H])c1F |
| InChI | InChI=1S/C10H13F/c1-10(2,3)8-4-6-9(11)7-5-8/h4-7H,1-3H3/i4D,5D,6D,7D |
| InChIKey | ISXPXFQBHNIYCU-UGWFXTGHSA-N |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |