C25H38N2O4 — CID 130396054
(1S,9S,13R)-10-(cyclopropylmethyl)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one (PubChem CID 130396054) has the molecular formula C25H38N2O4 and a molecular weight of 430.59 g/mol. Its IUPAC name is (1S,9S,13R)-10-(cyclopropylmethyl)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one.
| Compound Name | (1S,9S,13R)-10-(cyclopropylmethyl)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 130396054 |
| Molecular Formula | C25H38N2O4 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | (1S,9S,13R)-10-(cyclopropylmethyl)-4-[2-[2-(2-methoxyethoxy)ethoxy]ethylamino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
| SMILES | COCCOCCOCCNc1ccc2c(c1)[C@@]1(C)CCN(CC3CC3)[C@H](C2=O)[C@@H]1C |
| InChI | InChI=1S/C25H38N2O4/c1-18-23-24(28)21-7-6-20(26-9-11-30-14-15-31-13-12-29-3)16-22(21)25(18,2)8-10-27(23)17-19-4-5-19/h6-7,16,18-19,23,26H,4-5,8-15,17H2,1-3H3/t18-,23-,25-/m0/s1 |
| InChIKey | AZUWVIGALJZGFG-WYRQLCSISA-N |
| XLogP | 3.35 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|