C27H42Cl14O — CID 130396098
1,2,3,4,5,6,7,8,9,10,11,13,15,16-tetradecachloro-1-(3,3-dimethylbutoxy)-12,14,17-trimethyloctadecane (PubChem CID 130396098) has the molecular formula C27H42Cl14O and a molecular weight of 878.97 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,10,11,13,15,16-tetradecachloro-1-(3,3-dimethylbutoxy)-12,14,17-trimethyloctadecane.
| Compound Name | 1,2,3,4,5,6,7,8,9,10,11,13,15,16-tetradecachloro-1-(3,3-dimethylbutoxy)-12,14,17-trimethyloctadecane |
|---|---|
| PubChem CID | 130396098 |
| Molecular Formula | C27H42Cl14O |
| Molecular Weight | 878.97 g/mol |
| Exact Mass | 871.89 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10,11,13,15,16-tetradecachloro-1-(3,3-dimethylbutoxy)-12,14,17-trimethyloctadecane |
| SMILES | CC(C)C(Cl)C(Cl)C(C)C(Cl)C(C)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C(Cl)OCCC(C)(C)C |
| InChI | InChI=1S/C27H42Cl14O/c1-10(2)13(28)15(30)11(3)14(29)12(4)16(31)17(32)18(33)19(34)20(35)21(36)22(37)23(38)24(39)25(40)26(41)42-9-8-27(5,6)7/h10-26H,8-9H2,1-7H3 |
| InChIKey | OJWCTEIYPFLDFC-UHFFFAOYSA-N |
| XLogP | 12.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.97 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|