C14H23NO — CID 130396675
4,6-ditert-butyl-3,5-dihydro-1H-furo[3,4-c]pyrrole (PubChem CID 130396675) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 4,6-ditert-butyl-3,5-dihydro-1H-furo[3,4-c]pyrrole.
| Compound Name | 4,6-ditert-butyl-3,5-dihydro-1H-furo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 130396675 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4,6-ditert-butyl-3,5-dihydro-1H-furo[3,4-c]pyrrole |
| SMILES | CC(C)(C)c1[nH]c(C(C)(C)C)c2c1COC2 |
| InChI | InChI=1S/C14H23NO/c1-13(2,3)11-9-7-16-8-10(9)12(15-11)14(4,5)6/h15H,7-8H2,1-6H3 |
| InChIKey | LPBNAXFPBRESQE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |