C20H34O — CID 13039671
6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbaldehyde (PubChem CID 13039671) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbaldehyde.
| Compound Name | 6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 13039671 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbaldehyde |
| SMILES | CCCC1CCC(C2CCC3CC(C=O)CCC3C2)CC1 |
| InChI | InChI=1S/C20H34O/c1-2-3-15-4-7-17(8-5-15)19-11-10-18-12-16(14-21)6-9-20(18)13-19/h14-20H,2-13H2,1H3 |
| InChIKey | GFYCVNWJIWSYFZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|