About 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide
4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide (PubChem CID 1303969) has the molecular formula C19H17ClFN3O
and a molecular weight of 357.82 g/mol. Its IUPAC name is 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide.
Molecular Properties
| Compound Name | 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide |
| PubChem CID | 1303969 |
| Molecular Formula | C19H17ClFN3O |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)Nc3ccccc3F)cc2)c(C)c1Cl |
| InChI | InChI=1S/C19H17ClFN3O/c1-12-18(20)13(2)24(23-12)11-14-7-9-15(10-8-14)19(25)22-17-6-4-3-5-16(17)21/h3-10H,11H2,1-2H3,(H,22,25) |
| InChIKey | YCQBTXLVGSRYCK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide?
The IUPAC name of 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide (CID 1303969) is 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide.
What is the SMILES notation for 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide?
The canonical SMILES for 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide is Cc1nn(Cc2ccc(C(=O)Nc3ccccc3F)cc2)c(C)c1Cl.
What is the InChIKey of 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide?
The InChIKey is YCQBTXLVGSRYCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClFN3O/c1-12-18(20)13(2)24(23-12)11-14-7-9-15(10-8-14)19(25)22-17-6-4-3-5-16(17)21/h3-10H,11H2,1-2H3,(H,22,25).
What are the key properties of 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide?
4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide has a molecular weight of 357.82 g/mol, XLogP of 4.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-(2-fluorophenyl)benzamide is sourced from PubChem (CID 1303969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).