About N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine
N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine (PubChem CID 130397314) has the molecular formula C9H19F2N
and a molecular weight of 179.25 g/mol. Its IUPAC name is N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine |
| PubChem CID | 130397314 |
| Molecular Formula | C9H19F2N |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)NC(F)(F)C(C)(C)C |
| InChI | InChI=1S/C9H19F2N/c1-7(2,3)9(10,11)12-8(4,5)6/h12H,1-6H3 |
| InChIKey | YFGQMMBVBPYTLU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine?
The IUPAC name of N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine (CID 130397314) is N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine.
What is the SMILES notation for N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine?
The canonical SMILES for N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine is CC(C)(C)NC(F)(F)C(C)(C)C.
What is the InChIKey of N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine?
The InChIKey is YFGQMMBVBPYTLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F2N/c1-7(2,3)9(10,11)12-8(4,5)6/h12H,1-6H3.
What are the key properties of N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine?
N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine has a molecular weight of 179.25 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1,1-difluoro-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 130397314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).