About 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid
2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid (PubChem CID 130398777) has the molecular formula C20H25NO2S
and a molecular weight of 343.49 g/mol. Its IUPAC name is 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| PubChem CID | 130398777 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| SMILES | CN(Cc1ccccc1)Cc1sc2c(c1C(=O)O)CC(C)(C)CC2 |
| InChI | InChI=1S/C20H25NO2S/c1-20(2)10-9-16-15(11-20)18(19(22)23)17(24-16)13-21(3)12-14-7-5-4-6-8-14/h4-8H,9-13H2,1-3H3,(H,22,23) |
| InChIKey | MVCLZKDHPBXARB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid?
The IUPAC name of 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid (CID 130398777) is 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid.
What is the SMILES notation for 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid?
The canonical SMILES for 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid is CN(Cc1ccccc1)Cc1sc2c(c1C(=O)O)CC(C)(C)CC2.
What is the InChIKey of 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid?
The InChIKey is MVCLZKDHPBXARB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO2S/c1-20(2)10-9-16-15(11-20)18(19(22)23)17(24-16)13-21(3)12-14-7-5-4-6-8-14/h4-8H,9-13H2,1-3H3,(H,22,23).
What are the key properties of 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid?
2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid has a molecular weight of 343.49 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[benzyl(methyl)amino]methyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid is sourced from PubChem (CID 130398777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).