About N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine
N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine (PubChem CID 130399393) has the molecular formula C15H20N2S
and a molecular weight of 260.41 g/mol. Its IUPAC name is N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine |
| PubChem CID | 130399393 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc2nc(N(C)C3CCCCC3)sc2c1 |
| InChI | InChI=1S/C15H20N2S/c1-11-8-9-13-14(10-11)18-15(16-13)17(2)12-6-4-3-5-7-12/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | PKFLPGUSAJOLGD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine?
The IUPAC name of N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine (CID 130399393) is N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine?
The canonical SMILES for N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine is Cc1ccc2nc(N(C)C3CCCCC3)sc2c1.
What is the InChIKey of N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine?
The InChIKey is PKFLPGUSAJOLGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2S/c1-11-8-9-13-14(10-11)18-15(16-13)17(2)12-6-4-3-5-7-12/h8-10,12H,3-7H2,1-2H3.
What are the key properties of N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine?
N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine has a molecular weight of 260.41 g/mol, XLogP of 4.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N,6-dimethyl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 130399393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).