C14H22O4 — CID 130399511
(4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-oct-4-enyl]cyclohex-2-en-1-one (PubChem CID 130399511) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-oct-4-enyl]cyclohex-2-en-1-one.
| Compound Name | (4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-oct-4-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 130399511 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-oct-4-enyl]cyclohex-2-en-1-one |
| SMILES | CCC/C=C\CCC[C@]1(O)C(=O)C=C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H22O4/c1-2-3-4-5-6-7-10-14(18)12(16)9-8-11(15)13(14)17/h4-5,8-9,11,13,15,17-18H,2-3,6-7,10H2,1H3/b5-4-/t11-,13+,14-/m0/s1 |
| InChIKey | BDFFGPXNAKZXOR-PKZMUJFRSA-N |
| XLogP | 1.10 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|