C16H26O6 — CID 130399520
(3aR,4S,7R,7aS)-7a-[(Z)-5,5-dimethoxypent-1-enyl]-2,2-dimethyl-4,7-dihydro-3aH-1,3-benzodioxole-4,7-diol (PubChem CID 130399520) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-7a-[(Z)-5,5-dimethoxypent-1-enyl]-2,2-dimethyl-4,7-dihydro-3aH-1,3-benzodioxole-4,7-diol.
| Compound Name | (3aR,4S,7R,7aS)-7a-[(Z)-5,5-dimethoxypent-1-enyl]-2,2-dimethyl-4,7-dihydro-3aH-1,3-benzodioxole-4,7-diol |
|---|---|
| PubChem CID | 130399520 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (3aR,4S,7R,7aS)-7a-[(Z)-5,5-dimethoxypent-1-enyl]-2,2-dimethyl-4,7-dihydro-3aH-1,3-benzodioxole-4,7-diol |
| SMILES | COC(CC/C=C\[C@@]12OC(C)(C)O[C@@H]1[C@@H](O)C=C[C@H]2O)OC |
| InChI | InChI=1S/C16H26O6/c1-15(2)21-14-11(17)8-9-12(18)16(14,22-15)10-6-5-7-13(19-3)20-4/h6,8-14,17-18H,5,7H2,1-4H3/b10-6-/t11-,12+,14+,16-/m0/s1 |
| InChIKey | MXPAIOYAUKUIEJ-CTBWUZJCSA-N |
| XLogP | 1.12 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|