C20H14Br2O2 — CID 130399684
5,10-dibromopentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8(13),9,11-hexaene-16,19-dione (PubChem CID 130399684) has the molecular formula C20H14Br2O2 and a molecular weight of 446.14 g/mol. Its IUPAC name is 5,10-dibromopentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8(13),9,11-hexaene-16,19-dione.
| Compound Name | 5,10-dibromopentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8(13),9,11-hexaene-16,19-dione |
|---|---|
| PubChem CID | 130399684 |
| Molecular Formula | C20H14Br2O2 |
| Molecular Weight | 446.14 g/mol |
| Exact Mass | 443.94 |
| IUPAC Name | 5,10-dibromopentacyclo[12.3.3.01,14.02,7.08,13]icosa-2(7),3,5,8(13),9,11-hexaene-16,19-dione |
| SMILES | O=C1CC23CC(=O)CC2(C1)c1ccc(Br)cc1-c1cc(Br)ccc13 |
| InChI | InChI=1S/C20H14Br2O2/c21-11-1-3-17-15(5-11)16-6-12(22)2-4-18(16)20-9-13(23)7-19(17,20)8-14(24)10-20/h1-6H,7-10H2 |
| InChIKey | DKNWMBFRHMHPDN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.14 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |