C13H21NS — CID 130400153
(5E,7Z)-6-tert-butyl-9-ethyl-4,9-dihydro-1,3-thiazonine (PubChem CID 130400153) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is (5E,7Z)-6-tert-butyl-9-ethyl-4,9-dihydro-1,3-thiazonine.
| Compound Name | (5E,7Z)-6-tert-butyl-9-ethyl-4,9-dihydro-1,3-thiazonine |
|---|---|
| PubChem CID | 130400153 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (5E,7Z)-6-tert-butyl-9-ethyl-4,9-dihydro-1,3-thiazonine |
| SMILES | CCC1/C=C\C(C(C)(C)C)=C/C/N=C\S1 |
| InChI | InChI=1S/C13H21NS/c1-5-12-7-6-11(13(2,3)4)8-9-14-10-15-12/h6-8,10,12H,5,9H2,1-4H3/b7-6-,11-8+,14-10- |
| InChIKey | WPPROSJXRILXMY-XBQIXNMESA-N |
| XLogP | 4.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |