C26H32N2O3 — CID 130400437
(1R,13R)-10-(cyclopropylmethyl)-4-[4-(2-hydroxyethoxy)anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one (PubChem CID 130400437) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is (1R,13R)-10-(cyclopropylmethyl)-4-[4-(2-hydroxyethoxy)anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one.
| Compound Name | (1R,13R)-10-(cyclopropylmethyl)-4-[4-(2-hydroxyethoxy)anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 130400437 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | (1R,13R)-10-(cyclopropylmethyl)-4-[4-(2-hydroxyethoxy)anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
| SMILES | C[C@H]1C2C(=O)c3ccc(Nc4ccc(OCCO)cc4)cc3[C@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C26H32N2O3/c1-17-24-25(30)22-10-7-20(27-19-5-8-21(9-6-19)31-14-13-29)15-23(22)26(17,2)11-12-28(24)16-18-3-4-18/h5-10,15,17-18,24,27,29H,3-4,11-14,16H2,1-2H3/t17-,24?,26+/m0/s1 |
| InChIKey | FCBUHMPXHZKIFS-UMDWWPMNSA-N |
| XLogP | 4.38 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |