C33H35NO3 — CID 130400556
[4-[3-[3-(2-methylbutan-2-yloxy)anilino]phenoxy]phenyl]-(4-propan-2-ylphenyl)methanone (PubChem CID 130400556) has the molecular formula C33H35NO3 and a molecular weight of 493.65 g/mol. Its IUPAC name is [4-[3-[3-(2-methylbutan-2-yloxy)anilino]phenoxy]phenyl]-(4-propan-2-ylphenyl)methanone.
| Compound Name | [4-[3-[3-(2-methylbutan-2-yloxy)anilino]phenoxy]phenyl]-(4-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 130400556 |
| Molecular Formula | C33H35NO3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | [4-[3-[3-(2-methylbutan-2-yloxy)anilino]phenoxy]phenyl]-(4-propan-2-ylphenyl)methanone |
| SMILES | CCC(C)(C)Oc1cccc(Nc2cccc(Oc3ccc(C(=O)c4ccc(C(C)C)cc4)cc3)c2)c1 |
| InChI | InChI=1S/C33H35NO3/c1-6-33(4,5)37-31-12-8-10-28(22-31)34-27-9-7-11-30(21-27)36-29-19-17-26(18-20-29)32(35)25-15-13-24(14-16-25)23(2)3/h7-23,34H,6H2,1-5H3 |
| InChIKey | RGSMJWWUYQSLEF-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |