C37H32F6O8S — CID 130400567
5-[2-[3-carboxy-4-(2-methylbutan-2-yloxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-(4-prop-1-en-2-ylphenyl)sulfonylphenoxy]benzoic acid (PubChem CID 130400567) has the molecular formula C37H32F6O8S and a molecular weight of 750.71 g/mol. Its IUPAC name is 5-[2-[3-carboxy-4-(2-methylbutan-2-yloxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-(4-prop-1-en-2-ylphenyl)sulfonylphenoxy]benzoic acid.
| Compound Name | 5-[2-[3-carboxy-4-(2-methylbutan-2-yloxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-(4-prop-1-en-2-ylphenyl)sulfonylphenoxy]benzoic acid |
|---|---|
| PubChem CID | 130400567 |
| Molecular Formula | C37H32F6O8S |
| Molecular Weight | 750.71 g/mol |
| Exact Mass | 750.17 |
| IUPAC Name | 5-[2-[3-carboxy-4-(2-methylbutan-2-yloxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[4-(4-prop-1-en-2-ylphenyl)sulfonylphenoxy]benzoic acid |
| SMILES | C=C(C)c1ccc(S(=O)(=O)c2ccc(Oc3ccc(C(c4ccc(OC(C)(C)CC)c(C(=O)O)c4)(C(F)(F)F)C(F)(F)F)cc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C37H32F6O8S/c1-6-34(4,5)51-31-18-10-24(20-29(31)33(46)47)35(36(38,39)40,37(41,42)43)23-9-17-30(28(19-23)32(44)45)50-25-11-15-27(16-12-25)52(48,49)26-13-7-22(8-14-26)21(2)3/h7-20H,2,6H2,1,3-5H3,(H,44,45)(H,46,47) |
| InChIKey | NRWSGLIXGCMYIM-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.71 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |