C22H37N — CID 130401380
7-tert-butyl-3-methyl-4-[(3E,5E)-2,7,7-trimethylocta-3,5-dien-3-yl]-2,3-dihydro-1H-azepine (PubChem CID 130401380) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is 7-tert-butyl-3-methyl-4-[(3E,5E)-2,7,7-trimethylocta-3,5-dien-3-yl]-2,3-dihydro-1H-azepine.
| Compound Name | 7-tert-butyl-3-methyl-4-[(3E,5E)-2,7,7-trimethylocta-3,5-dien-3-yl]-2,3-dihydro-1H-azepine |
|---|---|
| PubChem CID | 130401380 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | 7-tert-butyl-3-methyl-4-[(3E,5E)-2,7,7-trimethylocta-3,5-dien-3-yl]-2,3-dihydro-1H-azepine |
| SMILES | CC1CNC(C(C)(C)C)=CC=C1/C(=C/C=C/C(C)(C)C)C(C)C |
| InChI | InChI=1S/C22H37N/c1-16(2)18(11-10-14-21(4,5)6)19-12-13-20(22(7,8)9)23-15-17(19)3/h10-14,16-17,23H,15H2,1-9H3/b14-10+,18-11+ |
| InChIKey | POEWGTGBTFOIRM-HIMLSBAZSA-N |
| XLogP | 6.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|