C11H21NO2 — CID 130401910
(3R)-2,3,7,9-tetramethyl-6,10-dioxa-2-azaspiro[4.5]decane (PubChem CID 130401910) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (3R)-2,3,7,9-tetramethyl-6,10-dioxa-2-azaspiro[4.5]decane.
| Compound Name | (3R)-2,3,7,9-tetramethyl-6,10-dioxa-2-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 130401910 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (3R)-2,3,7,9-tetramethyl-6,10-dioxa-2-azaspiro[4.5]decane |
| SMILES | CC1CC(C)OC2(C[C@@H](C)N(C)C2)O1 |
| InChI | InChI=1S/C11H21NO2/c1-8-6-11(7-12(8)4)13-9(2)5-10(3)14-11/h8-10H,5-7H2,1-4H3/t8-,9?,10?,11?/m1/s1 |
| InChIKey | QTWOIJNWSAJAHV-XUHYKBHQSA-N |
| XLogP | 1.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |