About 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile
6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile (PubChem CID 130402631) has the molecular formula C12H14ClFN4
and a molecular weight of 268.72 g/mol. Its IUPAC name is 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile |
| PubChem CID | 130402631 |
| Molecular Formula | C12H14ClFN4 |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile |
| SMILES | N#Cc1cc(F)c(N[C@H]2CCC[C@@H](N)C2)nc1Cl |
| InChI | InChI=1S/C12H14ClFN4/c13-11-7(6-15)4-10(14)12(18-11)17-9-3-1-2-8(16)5-9/h4,8-9H,1-3,5,16H2,(H,17,18)/t8-,9+/m1/s1 |
| InChIKey | AKQNIKPFYHEIHS-BDAKNGLRSA-N |
| XLogP | 2.43 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile?
The IUPAC name of 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile (CID 130402631) is 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile.
What is the SMILES notation for 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile?
The canonical SMILES for 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile is N#Cc1cc(F)c(N[C@H]2CCC[C@@H](N)C2)nc1Cl.
What is the InChIKey of 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile?
The InChIKey is AKQNIKPFYHEIHS-BDAKNGLRSA-N. The full InChI is InChI=1S/C12H14ClFN4/c13-11-7(6-15)4-10(14)12(18-11)17-9-3-1-2-8(16)5-9/h4,8-9H,1-3,5,16H2,(H,17,18)/t8-,9+/m1/s1.
What are the key properties of 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile?
6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile has a molecular weight of 268.72 g/mol, XLogP of 2.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(1S,3R)-3-aminocyclohexyl]amino]-2-chloro-5-fluoropyridine-3-carbonitrile is sourced from PubChem (CID 130402631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).