C34H28Br2N2 — CID 130402671
N,N-bis(4-bromo-3-methylphenyl)-6-methyl-9-(4-methylphenyl)carbazol-3-amine (PubChem CID 130402671) has the molecular formula C34H28Br2N2 and a molecular weight of 624.42 g/mol. Its IUPAC name is N,N-bis(4-bromo-3-methylphenyl)-6-methyl-9-(4-methylphenyl)carbazol-3-amine.
| Compound Name | N,N-bis(4-bromo-3-methylphenyl)-6-methyl-9-(4-methylphenyl)carbazol-3-amine |
|---|---|
| PubChem CID | 130402671 |
| Molecular Formula | C34H28Br2N2 |
| Molecular Weight | 624.42 g/mol |
| Exact Mass | 622.06 |
| IUPAC Name | N,N-bis(4-bromo-3-methylphenyl)-6-methyl-9-(4-methylphenyl)carbazol-3-amine |
| SMILES | Cc1ccc(-n2c3ccc(C)cc3c3cc(N(c4ccc(Br)c(C)c4)c4ccc(Br)c(C)c4)ccc32)cc1 |
| InChI | InChI=1S/C34H28Br2N2/c1-21-5-8-25(9-6-21)38-33-15-7-22(2)17-29(33)30-20-28(12-16-34(30)38)37(26-10-13-31(35)23(3)18-26)27-11-14-32(36)24(4)19-27/h5-20H,1-4H3 |
| InChIKey | KQKDYBMLRVJAOY-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.42 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |