C25H21F2NO6 — CID 130403133
methyl 4-[(2,4-difluorophenyl)methylcarbamoyl]-3-oxo-6-(2-oxoethyl)-2-phenylmethoxycyclohexa-1,4-diene-1-carboxylate (PubChem CID 130403133) has the molecular formula C25H21F2NO6 and a molecular weight of 469.44 g/mol. Its IUPAC name is methyl 4-[(2,4-difluorophenyl)methylcarbamoyl]-3-oxo-6-(2-oxoethyl)-2-phenylmethoxycyclohexa-1,4-diene-1-carboxylate.
| Compound Name | methyl 4-[(2,4-difluorophenyl)methylcarbamoyl]-3-oxo-6-(2-oxoethyl)-2-phenylmethoxycyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 130403133 |
| Molecular Formula | C25H21F2NO6 |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | methyl 4-[(2,4-difluorophenyl)methylcarbamoyl]-3-oxo-6-(2-oxoethyl)-2-phenylmethoxycyclohexa-1,4-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(OCc2ccccc2)C(=O)C(C(=O)NCc2ccc(F)cc2F)=CC1CC=O |
| InChI | InChI=1S/C25H21F2NO6/c1-33-25(32)21-16(9-10-29)11-19(22(30)23(21)34-14-15-5-3-2-4-6-15)24(31)28-13-17-7-8-18(26)12-20(17)27/h2-8,10-12,16H,9,13-14H2,1H3,(H,28,31) |
| InChIKey | FUACFXZFYLWHTK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|