C26H35NO3S — CID 130403202
2-[3-(aminooxymethyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid (PubChem CID 130403202) has the molecular formula C26H35NO3S and a molecular weight of 441.64 g/mol. Its IUPAC name is 2-[3-(aminooxymethyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[3-(aminooxymethyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 130403202 |
| Molecular Formula | C26H35NO3S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 2-[3-(aminooxymethyl)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| SMILES | CC1(C)CCc2sc(-c3cc4c(cc3CON)C(C)(C)CCC4(C)C)c(C(=O)O)c2C1 |
| InChI | InChI=1S/C26H35NO3S/c1-24(2)8-7-20-17(13-24)21(23(28)29)22(31-20)16-12-19-18(11-15(16)14-30-27)25(3,4)9-10-26(19,5)6/h11-12H,7-10,13-14,27H2,1-6H3,(H,28,29) |
| InChIKey | PKCIZQVCDMLKKL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|