C20H23N3O2S2 — CID 130403647
2-[5-[[amino(methyl)amino]methyl]thieno[2,3-b]pyridin-4-yl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid (PubChem CID 130403647) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 2-[5-[[amino(methyl)amino]methyl]thieno[2,3-b]pyridin-4-yl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[5-[[amino(methyl)amino]methyl]thieno[2,3-b]pyridin-4-yl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 130403647 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-[5-[[amino(methyl)amino]methyl]thieno[2,3-b]pyridin-4-yl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| SMILES | CN(N)Cc1cnc2sccc2c1-c1sc2c(c1C(=O)O)CC(C)(C)CC2 |
| InChI | InChI=1S/C20H23N3O2S2/c1-20(2)6-4-14-13(8-20)16(19(24)25)17(27-14)15-11(10-23(3)21)9-22-18-12(15)5-7-26-18/h5,7,9H,4,6,8,10,21H2,1-3H3,(H,24,25) |
| InChIKey | FQRSTGZWOSPJDU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|