About N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide
N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide (PubChem CID 130403712) has the molecular formula C14H12F2N2O2
and a molecular weight of 278.26 g/mol. Its IUPAC name is N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide.
Molecular Properties
| Compound Name | N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide |
| PubChem CID | 130403712 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide |
| SMILES | NCNC(=O)c1cc(-c2ccc(F)cc2F)ccc1O |
| InChI | InChI=1S/C14H12F2N2O2/c15-9-2-3-10(12(16)6-9)8-1-4-13(19)11(5-8)14(20)18-7-17/h1-6,19H,7,17H2,(H,18,20) |
| InChIKey | ODBKJJXBWBARCR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide?
The IUPAC name of N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide (CID 130403712) is N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide.
What is the SMILES notation for N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide?
The canonical SMILES for N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide is NCNC(=O)c1cc(-c2ccc(F)cc2F)ccc1O.
What is the InChIKey of N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide?
The InChIKey is ODBKJJXBWBARCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N2O2/c15-9-2-3-10(12(16)6-9)8-1-4-13(19)11(5-8)14(20)18-7-17/h1-6,19H,7,17H2,(H,18,20).
What are the key properties of N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide?
N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide has a molecular weight of 278.26 g/mol, XLogP of 1.98, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(aminomethyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide is sourced from PubChem (CID 130403712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).