C8H12O4 — CID 130404257
(4S,5R,6R)-6-ethyl-4,5,6-trihydroxycyclohex-2-en-1-one (PubChem CID 130404257) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (4S,5R,6R)-6-ethyl-4,5,6-trihydroxycyclohex-2-en-1-one.
| Compound Name | (4S,5R,6R)-6-ethyl-4,5,6-trihydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 130404257 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (4S,5R,6R)-6-ethyl-4,5,6-trihydroxycyclohex-2-en-1-one |
| SMILES | CC[C@]1(O)C(=O)C=C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H12O4/c1-2-8(12)6(10)4-3-5(9)7(8)11/h3-5,7,9,11-12H,2H2,1H3/t5-,7+,8-/m0/s1 |
| InChIKey | DLXABXXSRUOGJW-ARDNSNSESA-N |
| XLogP | -1.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |