About 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan
5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan (PubChem CID 130404285) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan.
Molecular Properties
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan |
| PubChem CID | 130404285 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan |
| SMILES | C=C/C=C\C1=C(C=C)CC(C)(C)O1 |
| InChI | InChI=1S/C12H16O/c1-5-7-8-11-10(6-2)9-12(3,4)13-11/h5-8H,1-2,9H2,3-4H3/b8-7- |
| InChIKey | PZRBUPBBQPJHOQ-FPLPWBNLSA-N |
| XLogP | 3.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan?
The IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan (CID 130404285) is 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan.
What is the SMILES notation for 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan?
The canonical SMILES for 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan is C=C/C=C\C1=C(C=C)CC(C)(C)O1.
What is the InChIKey of 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan?
The InChIKey is PZRBUPBBQPJHOQ-FPLPWBNLSA-N. The full InChI is InChI=1S/C12H16O/c1-5-7-8-11-10(6-2)9-12(3,4)13-11/h5-8H,1-2,9H2,3-4H3/b8-7-.
What are the key properties of 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan?
5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan has a molecular weight of 176.26 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-2,2-dimethyl-3H-furan is sourced from PubChem (CID 130404285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).