About azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine
azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine (PubChem CID 130404363) has the molecular formula C3H11N2O3P
and a molecular weight of 154.11 g/mol. Its IUPAC name is azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine.
Molecular Properties
| Compound Name | azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine |
| PubChem CID | 130404363 |
| Molecular Formula | C3H11N2O3P |
| Molecular Weight | 154.11 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine |
| SMILES | N.NCP1(=O)OCCO1 |
| InChI | InChI=1S/C3H8NO3P.H3N/c4-3-8(5)6-1-2-7-8;/h1-4H2;1H3 |
| InChIKey | BQQZRUSFKBLDST-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.11 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine?
The IUPAC name of azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine (CID 130404363) is azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine.
What is the SMILES notation for azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine?
The canonical SMILES for azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine is N.NCP1(=O)OCCO1.
What is the InChIKey of azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine?
The InChIKey is BQQZRUSFKBLDST-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8NO3P.H3N/c4-3-8(5)6-1-2-7-8;/h1-4H2;1H3.
What are the key properties of azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine?
azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine has a molecular weight of 154.11 g/mol, XLogP of 0.30, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)methanamine is sourced from PubChem (CID 130404363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).