C22H21NO2S4 — CID 130404464
11-octyl-3,7,15,19-tetrathia-11-azapentacyclo[11.6.0.02,9.04,8.014,18]nonadeca-1(13),2(9),4(8),5,14(18),16-hexaene-10,12-dione (PubChem CID 130404464) has the molecular formula C22H21NO2S4 and a molecular weight of 459.68 g/mol. Its IUPAC name is 11-octyl-3,7,15,19-tetrathia-11-azapentacyclo[11.6.0.02,9.04,8.014,18]nonadeca-1(13),2(9),4(8),5,14(18),16-hexaene-10,12-dione.
| Compound Name | 11-octyl-3,7,15,19-tetrathia-11-azapentacyclo[11.6.0.02,9.04,8.014,18]nonadeca-1(13),2(9),4(8),5,14(18),16-hexaene-10,12-dione |
|---|---|
| PubChem CID | 130404464 |
| Molecular Formula | C22H21NO2S4 |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 11-octyl-3,7,15,19-tetrathia-11-azapentacyclo[11.6.0.02,9.04,8.014,18]nonadeca-1(13),2(9),4(8),5,14(18),16-hexaene-10,12-dione |
| SMILES | CCCCCCCCn1c(=O)c2c3sccc3sc2c2sc3ccsc3c2c1=O |
| InChI | InChI=1S/C22H21NO2S4/c1-2-3-4-5-6-7-10-23-21(24)15-17-13(8-11-26-17)28-19(15)20-16(22(23)25)18-14(29-20)9-12-27-18/h8-9,11-12H,2-7,10H2,1H3 |
| InChIKey | NSUJHCDUHZRWMS-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|