About 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid
2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid (PubChem CID 130405416) has the molecular formula C8H6F5NO4S
and a molecular weight of 307.20 g/mol. Its IUPAC name is 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid |
| PubChem CID | 130405416 |
| Molecular Formula | C8H6F5NO4S |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(S(F)(F)(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6F5NO4S/c9-19(10,11,12,13)6-1-2-7(14(17)18)5(3-6)4-8(15)16/h1-3H,4H2,(H,15,16) |
| InChIKey | RHBMNPDBBAUFOA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid?
The IUPAC name of 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid (CID 130405416) is 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid.
What is the SMILES notation for 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid?
The canonical SMILES for 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid is O=C(O)Cc1cc(S(F)(F)(F)(F)F)ccc1[N+](=O)[O-].
What is the InChIKey of 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid?
The InChIKey is RHBMNPDBBAUFOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F5NO4S/c9-19(10,11,12,13)6-1-2-7(14(17)18)5(3-6)4-8(15)16/h1-3H,4H2,(H,15,16).
What are the key properties of 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid?
2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid has a molecular weight of 307.20 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid is sourced from PubChem (CID 130405416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).