C14H13LiN2O2 — CID 130405932
lithium 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)benzoate (PubChem CID 130405932) has the molecular formula C14H13LiN2O2 and a molecular weight of 248.21 g/mol. Its IUPAC name is lithium 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)benzoate.
| Compound Name | lithium 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)benzoate |
|---|---|
| PubChem CID | 130405932 |
| Molecular Formula | C14H13LiN2O2 |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | lithium 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)benzoate |
| SMILES | O=C([O-])c1ccc(-c2ncc3n2CCCC3)cc1.[Li+] |
| InChI | InChI=1S/C14H14N2O2.Li/c17-14(18)11-6-4-10(5-7-11)13-15-9-12-3-1-2-8-16(12)13;/h4-7,9H,1-3,8H2,(H,17,18);/q;+1/p-1 |
| InChIKey | QHHMKMBEKSYAGE-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |