C9H8N4O — CID 130406686
3,6,9,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one (PubChem CID 130406686) has the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. Its IUPAC name is 3,6,9,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one.
| Compound Name | 3,6,9,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one |
|---|---|
| PubChem CID | 130406686 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 3,6,9,10-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraen-12-one |
| SMILES | O=c1cnn2c(c1)-c1nccn1CC2 |
| InChI | InChI=1S/C9H8N4O/c14-7-5-8-9-10-1-2-12(9)3-4-13(8)11-6-7/h1-2,5-6H,3-4H2 |
| InChIKey | YGUCZXNJWOKNTF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |