C18H17BrN2O3 — CID 130406838
6-bromo-3-[(2,3-dimethoxy-4-pyridinyl)methyl]-2-methoxyquinoline (PubChem CID 130406838) has the molecular formula C18H17BrN2O3 and a molecular weight of 389.25 g/mol. Its IUPAC name is 6-bromo-3-[(2,3-dimethoxy-4-pyridinyl)methyl]-2-methoxyquinoline.
| Compound Name | 6-bromo-3-[(2,3-dimethoxy-4-pyridinyl)methyl]-2-methoxyquinoline |
|---|---|
| PubChem CID | 130406838 |
| Molecular Formula | C18H17BrN2O3 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 6-bromo-3-[(2,3-dimethoxy-4-pyridinyl)methyl]-2-methoxyquinoline |
| SMILES | COc1nc2ccc(Br)cc2cc1Cc1ccnc(OC)c1OC |
| InChI | InChI=1S/C18H17BrN2O3/c1-22-16-11(6-7-20-18(16)24-3)8-13-9-12-10-14(19)4-5-15(12)21-17(13)23-2/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | AQUMSZCWOCBRJQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |