C25H24Cl2N2O3 — CID 130407884
4,5-dichloro-N-[3-[4-(1-cyclopropyl-2-oxoethyl)phenyl]oxolan-3-yl]-1-methylindole-2-carboxamide (PubChem CID 130407884) has the molecular formula C25H24Cl2N2O3 and a molecular weight of 471.38 g/mol. Its IUPAC name is 4,5-dichloro-N-[3-[4-(1-cyclopropyl-2-oxoethyl)phenyl]oxolan-3-yl]-1-methylindole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-[3-[4-(1-cyclopropyl-2-oxoethyl)phenyl]oxolan-3-yl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 130407884 |
| Molecular Formula | C25H24Cl2N2O3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 4,5-dichloro-N-[3-[4-(1-cyclopropyl-2-oxoethyl)phenyl]oxolan-3-yl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)NC2(c3ccc(C(C=O)C4CC4)cc3)CCOC2)cc2c(Cl)c(Cl)ccc21 |
| InChI | InChI=1S/C25H24Cl2N2O3/c1-29-21-9-8-20(26)23(27)18(21)12-22(29)24(31)28-25(10-11-32-14-25)17-6-4-16(5-7-17)19(13-30)15-2-3-15/h4-9,12-13,15,19H,2-3,10-11,14H2,1H3,(H,28,31) |
| InChIKey | WMERZTUFDUSEDL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|