C10H8F11NO — CID 130408104
2,2,3,3,4,4,5,5-octafluoro-1-[1,2,2-trifluoro-2-(oxolan-2-yl)ethyl]pyrrolidine (PubChem CID 130408104) has the molecular formula C10H8F11NO and a molecular weight of 367.16 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-1-[1,2,2-trifluoro-2-(oxolan-2-yl)ethyl]pyrrolidine.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-1-[1,2,2-trifluoro-2-(oxolan-2-yl)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 130408104 |
| Molecular Formula | C10H8F11NO |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-1-[1,2,2-trifluoro-2-(oxolan-2-yl)ethyl]pyrrolidine |
| SMILES | FC(N1C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)C1CCCO1 |
| InChI | InChI=1S/C10H8F11NO/c11-5(6(12,13)4-2-1-3-23-4)22-9(18,19)7(14,15)8(16,17)10(22,20)21/h4-5H,1-3H2 |
| InChIKey | JDSDRYOHWNXSRH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|