C17H12F2N4O3S — CID 130408491
N-(3,4-difluorophenyl)-1-methyl-4-[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]pyrrole-2-carboxamide (PubChem CID 130408491) has the molecular formula C17H12F2N4O3S and a molecular weight of 390.37 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1-methyl-4-[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]pyrrole-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1-methyl-4-[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130408491 |
| Molecular Formula | C17H12F2N4O3S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-(3,4-difluorophenyl)-1-methyl-4-[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]pyrrole-2-carboxamide |
| SMILES | Cn1cc(C(=O)C(=O)Nc2nccs2)cc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H12F2N4O3S/c1-23-8-9(14(24)16(26)22-17-20-4-5-27-17)6-13(23)15(25)21-10-2-3-11(18)12(19)7-10/h2-8H,1H3,(H,21,25)(H,20,22,26) |
| InChIKey | JYIXZFBSQNCJMF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|