C18H17F2N3O4 — CID 130408563
N-(3,4-difluorophenyl)-1-methyl-4-(2-morpholin-4-yl-2-oxoacetyl)pyrrole-2-carboxamide (PubChem CID 130408563) has the molecular formula C18H17F2N3O4 and a molecular weight of 377.35 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1-methyl-4-(2-morpholin-4-yl-2-oxoacetyl)pyrrole-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1-methyl-4-(2-morpholin-4-yl-2-oxoacetyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130408563 |
| Molecular Formula | C18H17F2N3O4 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-(3,4-difluorophenyl)-1-methyl-4-(2-morpholin-4-yl-2-oxoacetyl)pyrrole-2-carboxamide |
| SMILES | Cn1cc(C(=O)C(=O)N2CCOCC2)cc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H17F2N3O4/c1-22-10-11(16(24)18(26)23-4-6-27-7-5-23)8-15(22)17(25)21-12-2-3-13(19)14(20)9-12/h2-3,8-10H,4-7H2,1H3,(H,21,25) |
| InChIKey | FSXOLYWUJQEDIZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|