C22H20F2N4O3 — CID 130408571
N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-(pyridin-2-ylmethylamino)acetyl]pyrrole-2-carboxamide (PubChem CID 130408571) has the molecular formula C22H20F2N4O3 and a molecular weight of 426.42 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-(pyridin-2-ylmethylamino)acetyl]pyrrole-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-(pyridin-2-ylmethylamino)acetyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130408571 |
| Molecular Formula | C22H20F2N4O3 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-(pyridin-2-ylmethylamino)acetyl]pyrrole-2-carboxamide |
| SMILES | Cc1c(C(=O)C(=O)NCc2ccccn2)c(C)n(C)c1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H20F2N4O3/c1-12-18(20(29)22(31)26-11-15-6-4-5-9-25-15)13(2)28(3)19(12)21(30)27-14-7-8-16(23)17(24)10-14/h4-10H,11H2,1-3H3,(H,26,31)(H,27,30) |
| InChIKey | NSLNATGFUYVCAE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|