C19H16F2N4O3S — CID 130408591
N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]pyrrole-2-carboxamide (PubChem CID 130408591) has the molecular formula C19H16F2N4O3S and a molecular weight of 418.43 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]pyrrole-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130408591 |
| Molecular Formula | C19H16F2N4O3S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]pyrrole-2-carboxamide |
| SMILES | Cc1c(C(=O)C(=O)Nc2nccs2)c(C)n(C)c1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H16F2N4O3S/c1-9-14(16(26)18(28)24-19-22-6-7-29-19)10(2)25(3)15(9)17(27)23-11-4-5-12(20)13(21)8-11/h4-8H,1-3H3,(H,23,27)(H,22,24,28) |
| InChIKey | VZFAGBWODUBWGT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|