C20H23F2N3O3 — CID 130408595
4-[2-(diethylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,3,5-trimethylpyrrole-2-carboxamide (PubChem CID 130408595) has the molecular formula C20H23F2N3O3 and a molecular weight of 391.42 g/mol. Its IUPAC name is 4-[2-(diethylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,3,5-trimethylpyrrole-2-carboxamide.
| Compound Name | 4-[2-(diethylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,3,5-trimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130408595 |
| Molecular Formula | C20H23F2N3O3 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 4-[2-(diethylamino)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1,3,5-trimethylpyrrole-2-carboxamide |
| SMILES | CCN(CC)C(=O)C(=O)c1c(C)c(C(=O)Nc2ccc(F)c(F)c2)n(C)c1C |
| InChI | InChI=1S/C20H23F2N3O3/c1-6-25(7-2)20(28)18(26)16-11(3)17(24(5)12(16)4)19(27)23-13-8-9-14(21)15(22)10-13/h8-10H,6-7H2,1-5H3,(H,23,27) |
| InChIKey | VPHQKCFDPNUTHD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|