C17H13F4N3O3 — CID 130408690
4-[2-(3,3-difluoroazetidin-1-yl)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 130408690) has the molecular formula C17H13F4N3O3 and a molecular weight of 383.30 g/mol. Its IUPAC name is 4-[2-(3,3-difluoroazetidin-1-yl)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[2-(3,3-difluoroazetidin-1-yl)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130408690 |
| Molecular Formula | C17H13F4N3O3 |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 4-[2-(3,3-difluoroazetidin-1-yl)-2-oxoacetyl]-N-(3,4-difluorophenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(C(=O)C(=O)N2CC(F)(F)C2)cc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H13F4N3O3/c1-23-6-9(14(25)16(27)24-7-17(20,21)8-24)4-13(23)15(26)22-10-2-3-11(18)12(19)5-10/h2-6H,7-8H2,1H3,(H,22,26) |
| InChIKey | UTBYAVKUWQOMTL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|